warffarin (Q407431)
Neidio i'r panel llywio
Neidio i'r bar chwilio
group of stereoisomers Saesneg
- 4-hydroxy-3-(3-oxo-1-phenylbutyl)coumarin
| Iaith | Label | Disgrifiad | Enwau eraill |
|---|---|---|---|
| Cymraeg | warffarin |
Ni phenwyd unrhyw ddisgrifiad eto |
|
| Saesneg | (RS)-warfarin |
group of stereoisomers |
|
Mynegiadau
-2H-chromen-2-one_200.svg)
308.104859 uned Dalton
1 ffynhonnell
CC(=O)CC(C1=CC=CC=C1)C2=C(C3=CC=CC=C3OC2=O)O
1 ffynhonnell
Warfarin
0 ffynonellau
Identifiers
1 ffynhonnell
InChIKey Saesneg
2 ffynonellau
ChEBI release 2020-09-01 Saesneg
2 ffynonellau
ChemSpider ID Saesneg
1 ffynhonnell
PubChem CID Saesneg
1 ffynhonnell
Reaxys registry number Saesneg
1293536
0 ffynonellau
ChEBI ID Saesneg
mapping relation type Saesneg
exact match Saesneg
ChEMBL ID Saesneg
SureChEMBL ID Saesneg
UniChem compound ID Saesneg
MassBank accession ID Saesneg
SPLASH Saesneg
CAMEO Chemicals ID Saesneg
ZVG number Saesneg
1 ffynhonnell
DSSTox substance ID Saesneg
DSSTOX compound identifier Saesneg
PesticideInfo chemical ID Saesneg
Probes And Drugs ID Saesneg
DrugCentral ID Saesneg
Rhestr y tudalennau sy'n cysylltu i'r eitem hon
Wicipedia(0 cofnodion)
Wicilyfrau(0 cofnodion)
Wicinewyddion(0 cofnodion)
Wiciddyfynnu(0 cofnodion)
Wicidestun(0 cofnodion)
Wiciysgol(0 cofnodion)
Wicidaith(0 cofnodion)
Wiciadur(0 cofnodion)
Gwefannau eraill(1 cofnod)
- commonswiki Category:Warfarin